CAS 133330-63-9 is the registry number for 4-Chloro Desloratadine. Offered by: TRC. Available pack sizes: 25mg.
7,13-dichloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaene (CAS 133330-63-9) is a chemical compound with the molecular formula C19H18Cl2N2 and a molecular weight of 345.3 g/mol. IUPAC name: 7,13-dichloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaene. InChIKey: CCXNJIKOLAJTLE-UHFFFAOYSA-N.
| Molecular formula | C19H18Cl2N2 |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | 7,13-dichloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaene |
| InChIKey | CCXNJIKOLAJTLE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CN=C2C(=C3CCNCC3)C4=C1C=C(C=C4)Cl)Cl |
Computed by PubChem (NCBI)