CAS 1333316-61-2 appears in our catalog under these names: Tenoxicam Impurity 3, 5-Chloro-2-methyl-thieno(2,3-d)-isothiazolidin-3-one-1,1-dioxide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
5-chloro-2-methyl-1,1-dioxothieno[2,3-d][1,2]thiazol-3-one (CAS 1333316-61-2) is a chemical compound with the molecular formula C6H4ClNO3S2 and a molecular weight of 237.7 g/mol. IUPAC name: 5-chloro-2-methyl-1,1-dioxothieno[2,3-d][1,2]thiazol-3-one. InChIKey: TZBWIXZWPHZTEG-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO3S2 |
|---|---|
| Molecular weight | 237.7 g/mol |
| IUPAC name | 5-chloro-2-methyl-1,1-dioxothieno[2,3-d][1,2]thiazol-3-one |
| InChIKey | TZBWIXZWPHZTEG-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(S1(=O)=O)C=C(S2)Cl |
Computed by PubChem (NCBI)