CAS 1333319-52-0 is the registry number for 5-Chloro-2,3-difluoropyridine-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-chloro-2,3-difluoropyridine-4-carbaldehyde (CAS 1333319-52-0) is a chemical compound with the molecular formula C6H2ClF2NO and a molecular weight of 177.53 g/mol. IUPAC name: 5-chloro-2,3-difluoropyridine-4-carbaldehyde. InChIKey: ICVYISQHWWFVEA-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO |
|---|---|
| Molecular weight | 177.53 g/mol |
| IUPAC name | 5-chloro-2,3-difluoropyridine-4-carbaldehyde |
| InChIKey | ICVYISQHWWFVEA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)F)F)C=O)Cl |
Computed by PubChem (NCBI)