CAS 1333327-56-2 appears in our catalog under these names: TRC051384 hydrochloride, 98%, TRC051384 Hydrochloride, TRC051384 HCl/ 98.29% (existing batch purity), TRC051384 Hydrochloride, TRC051384 (hydrochloride). Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 25mg, 2mg, 50mg, 100mg, 200mg.
1-(2-morpholin-4-ylethyl)-3-[4-[(E)-3-(6-morpholin-4-yl-2-pyridinyl)prop-2-enoyl]phenyl]urea;hydrochloride (CAS 1333327-56-2) is a chemical compound with the molecular formula C25H32ClN5O4 and a molecular weight of 502.0 g/mol. IUPAC name: 1-(2-morpholin-4-ylethyl)-3-[4-[(E)-3-(6-morpholin-4-yl-2-pyridinyl)prop-2-enoyl]phenyl]urea;hydrochloride. InChIKey: BCOFJDCZCSLJAM-HRNDJLQDSA-N.
| Molecular formula | C25H32ClN5O4 |
|---|---|
| Molecular weight | 502.0 g/mol |
| IUPAC name | 1-(2-morpholin-4-ylethyl)-3-[4-[(E)-3-(6-morpholin-4-yl-2-pyridinyl)prop-2-enoyl]phenyl]urea;hydrochloride |
| InChIKey | BCOFJDCZCSLJAM-HRNDJLQDSA-N |
| SMILES | C1COCCN1CCNC(=O)NC2=CC=C(C=C2)C(=O)/C=C/C3=NC(=CC=C3)N4CCOCC4.Cl |
Computed by PubChem (NCBI)