Products 1333375-02-2
CAS 1333375-02-2 is the registry number for BF-175. Offered by: MedChemExpress. Available pack sizes: 250 mg, 100 mg, 50 mg.
2-[4-[(E)-2-(3,5-dichlorophenyl)ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1333375-02-2) is a chemical compound with the molecular formula C20H21BCl2O2 and a molecular weight of 375.1 g/mol. IUPAC name: 2-[4-[(E)-2-(3,5-dichlorophenyl)ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QQAGHMVHZOMHPO-AATRIKPKSA-N.
| Molecular formula | C20H21BCl2O2 |
|---|---|
| Molecular weight | 375.1 g/mol |
| IUPAC name | 2-[4-[(E)-2-(3,5-dichlorophenyl)ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QQAGHMVHZOMHPO-AATRIKPKSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)/C=C/C3=CC(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)