CAS 1333377-78-8 is the registry number for Acetic acid, 2-[(1,3-dihydro-1,3-dioxo-2h-isoindol-2-yl)oxy]-, 2,5-dioxo-1-pyrrolidinyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(2,5-dioxopyrrolidin-1-yl) 2-(1,3-dioxoisoindol-2-yl)oxyacetate (CAS 1333377-78-8) is a chemical compound with the molecular formula C14H10N2O7 and a molecular weight of 318.24 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-(1,3-dioxoisoindol-2-yl)oxyacetate. InChIKey: ILKISXMROPLMCR-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O7 |
|---|---|
| Molecular weight | 318.24 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-(1,3-dioxoisoindol-2-yl)oxyacetate |
| InChIKey | ILKISXMROPLMCR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)