CAS 1333428-69-5 is the registry number for Cyclohexanecarboxaldehyde-d11. Offered by: TRC. Available pack sizes: 25mg.
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane-1-carbaldehyde (CAS 1333428-69-5) is a chemical compound with the molecular formula C7H12O and a molecular weight of 123.24 g/mol. IUPAC name: 1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane-1-carbaldehyde. InChIKey: KVFDZFBHBWTVID-BZNVDYMVSA-N.
| Molecular formula | C7H12O |
|---|---|
| Molecular weight | 123.24 g/mol |
| IUPAC name | 1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane-1-carbaldehyde |
| InChIKey | KVFDZFBHBWTVID-BZNVDYMVSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])C=O)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)