Products 1333493-11-0
CAS 1333493-11-0 is the registry number for rac-(3R,8aR)-Hexahydro-1H-pyrrolo(2,1-c)morpholine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3-carbonitrile (CAS 1333493-11-0) is a chemical compound with the molecular formula C8H12N2O and a molecular weight of 152.19 g/mol. IUPAC name: (3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3-carbonitrile. InChIKey: QTSMFXRROVYNJQ-JGVFFNPUSA-N.
| Molecular formula | C8H12N2O |
|---|---|
| Molecular weight | 152.19 g/mol |
| IUPAC name | (3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine-3-carbonitrile |
| InChIKey | QTSMFXRROVYNJQ-JGVFFNPUSA-N |
| SMILES | C1C[C@H]2CO[C@@H](CN2C1)C#N |
Computed by PubChem (NCBI)