Products 13335-73-4
CAS 13335-73-4 appears in our catalog under these names: 3,4-Dimethylphenoxyacetic acid, 98%, 3,4-Dimethylphenoxyacetic acid, 2-(3,4-Dimethylphenoxy)acetic acid, 97%, 97%, 3,4-Dimethylphenoxyacetic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 50g, 100g, 100mg, 250mg, 2.5g.
2-(3,4-dimethylphenoxy)acetic acid (CAS 13335-73-4) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-(3,4-dimethylphenoxy)acetic acid. InChIKey: GIEQJKZWTIFEJM-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-(3,4-dimethylphenoxy)acetic acid |
| InChIKey | GIEQJKZWTIFEJM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OCC(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
3,4-Xylyloxyacetic acid, Acetic acid, (3,4-dimethylphenoxy)-, 3,4-Dimethylphenoxyacetic acid, 2-(3,4-dimethylphenoxy)acetic acid, (3,4-dimethylphenoxy)acetic acid, Acetic acid, 2-(3,4-dimethylphenoxy)-, (3,4-dimethyl-phenoxy)acetic acid, (3,4-Dimethyl-phenoxy)-acetic acid, 2-(3,4-Dimethylphenoxy)Ethanoic Acid