CAS 133359-79-2 is the registry number for Dorzolamide Impurity 42. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3S)-3-thiophen-2-ylsulfanylbutanoate (CAS 133359-79-2) is a chemical compound with the molecular formula C9H12O2S2 and a molecular weight of 216.3 g/mol. IUPAC name: methyl (3S)-3-thiophen-2-ylsulfanylbutanoate. InChIKey: HWLDYKJDDGJZSN-ZETCQYMHSA-N.
| Molecular formula | C9H12O2S2 |
|---|---|
| Molecular weight | 216.3 g/mol |
| IUPAC name | methyl (3S)-3-thiophen-2-ylsulfanylbutanoate |
| InChIKey | HWLDYKJDDGJZSN-ZETCQYMHSA-N |
| SMILES | C[C@@H](CC(=O)OC)SC1=CC=CS1 |
Computed by PubChem (NCBI)