CAS 1333648-15-9 is the registry number for 4-(5-Imino-3,4-dimethyl-2,5-dihydro-1H-pyrazol-1-yl)benzonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(5-amino-3,4-dimethylpyrazol-1-yl)benzonitrile (CAS 1333648-15-9) is a chemical compound with the molecular formula C12H12N4 and a molecular weight of 212.25 g/mol. IUPAC name: 4-(5-amino-3,4-dimethylpyrazol-1-yl)benzonitrile. InChIKey: IFUWXFUUTGOZIZ-UHFFFAOYSA-N.
| Molecular formula | C12H12N4 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 4-(5-amino-3,4-dimethylpyrazol-1-yl)benzonitrile |
| InChIKey | IFUWXFUUTGOZIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1C)C2=CC=C(C=C2)C#N)N |
Computed by PubChem (NCBI)