Products 1333657-08-1
CAS 1333657-08-1 is the registry number for Methyl 2-amino-4-fluoro-5-(4-fluorophenoxy)benzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-amino-4-fluoro-5-(4-fluorophenoxy)benzoate (CAS 1333657-08-1) is a chemical compound with the molecular formula C14H11F2NO3 and a molecular weight of 279.24 g/mol. IUPAC name: methyl 2-amino-4-fluoro-5-(4-fluorophenoxy)benzoate. InChIKey: YRJBCRNYOKUEFW-UHFFFAOYSA-N.
| Molecular formula | C14H11F2NO3 |
|---|---|
| Molecular weight | 279.24 g/mol |
| IUPAC name | methyl 2-amino-4-fluoro-5-(4-fluorophenoxy)benzoate |
| InChIKey | YRJBCRNYOKUEFW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1N)F)OC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)