CAS 133367-32-5 appears in our catalog under these names: H-His(1-mtt)-oh, 95%, H-His(1-Mtt)-OH, (S)-2-Amino-3-(1-(diphenyl(p-tolyl)methyl)-1H-imidazol-4-yl)propanoic acid, 95+%. Offered by: Combi-blocks, Creative Peptides, AmBeed. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
(2S)-2-amino-3-[1-[(4-methylphenyl)-diphenylmethyl]imidazol-4-yl]propanoic acid (CAS 133367-32-5) is a chemical compound with the molecular formula C26H25N3O2 and a molecular weight of 411.5 g/mol. IUPAC name: (2S)-2-amino-3-[1-[(4-methylphenyl)-diphenylmethyl]imidazol-4-yl]propanoic acid. InChIKey: USIYUUIKLMCEIP-DEOSSOPVSA-N.
| Molecular formula | C26H25N3O2 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | (2S)-2-amino-3-[1-[(4-methylphenyl)-diphenylmethyl]imidazol-4-yl]propanoic acid |
| InChIKey | USIYUUIKLMCEIP-DEOSSOPVSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)