CAS 1333673-84-9 is the registry number for 2-(4-Fluoro-3-methylphenyl)-1H-imidazole hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(4-fluoro-3-methylphenyl)-1H-imidazole;hydrochloride (CAS 1333673-84-9) is a chemical compound with the molecular formula C10H10ClFN2 and a molecular weight of 212.65 g/mol. IUPAC name: 2-(4-fluoro-3-methylphenyl)-1H-imidazole;hydrochloride. InChIKey: OOBWGLZDZPTWJO-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFN2 |
|---|---|
| Molecular weight | 212.65 g/mol |
| IUPAC name | 2-(4-fluoro-3-methylphenyl)-1H-imidazole;hydrochloride |
| InChIKey | OOBWGLZDZPTWJO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=NC=CN2)F.Cl |
Computed by PubChem (NCBI)