Products 1333688-79-1
CAS 1333688-79-1 is the registry number for 3-Fluoro-4-(((3-methylpyridin-2-yl)methyl)amino)benzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-4-[(3-methyl-2-pyridinyl)methylamino]benzonitrile (CAS 1333688-79-1) is a chemical compound with the molecular formula C14H12FN3 and a molecular weight of 241.26 g/mol. IUPAC name: 3-fluoro-4-[(3-methyl-2-pyridinyl)methylamino]benzonitrile. InChIKey: DFQWNKXSLWIPSN-UHFFFAOYSA-N.
| Molecular formula | C14H12FN3 |
|---|---|
| Molecular weight | 241.26 g/mol |
| IUPAC name | 3-fluoro-4-[(3-methyl-2-pyridinyl)methylamino]benzonitrile |
| InChIKey | DFQWNKXSLWIPSN-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CC=C1)CNC2=C(C=C(C=C2)C#N)F |
Computed by PubChem (NCBI)