CAS 1333730-50-9 is the registry number for 4-Amino-2-(5-methyl-1H-1,2,3,4-tetrazol-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-amino-2-(5-methyltetrazol-1-yl)benzoic acid (CAS 1333730-50-9) is a chemical compound with the molecular formula C9H9N5O2 and a molecular weight of 219.20 g/mol. IUPAC name: 4-amino-2-(5-methyltetrazol-1-yl)benzoic acid. InChIKey: RYHJBANFFDGEPG-UHFFFAOYSA-N.
| Molecular formula | C9H9N5O2 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 4-amino-2-(5-methyltetrazol-1-yl)benzoic acid |
| InChIKey | RYHJBANFFDGEPG-UHFFFAOYSA-N |
| SMILES | CC1=NN=NN1C2=C(C=CC(=C2)N)C(=O)O |
Computed by PubChem (NCBI)