CAS 1333817-80-3 is the registry number for 4-(2,5-Dimethyl-1-(2,2,2-trifluoroethyl)-1H-pyrrol-3-yl)thiazol-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-1,3-thiazol-2-amine (CAS 1333817-80-3) is a chemical compound with the molecular formula C11H12F3N3S and a molecular weight of 275.30 g/mol. IUPAC name: 4-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-1,3-thiazol-2-amine. InChIKey: VGYPVGNMKMJMQO-UHFFFAOYSA-N.
| Molecular formula | C11H12F3N3S |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 4-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-1,3-thiazol-2-amine |
| InChIKey | VGYPVGNMKMJMQO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1CC(F)(F)F)C)C2=CSC(=N2)N |
Computed by PubChem (NCBI)