CAS 1333862-49-9 is the registry number for 1-(3-Bromo-4-methoxyphenyl)-3-(2,2,2-trifluoroethyl)urea, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-bromo-4-methoxyphenyl)-3-(2,2,2-trifluoroethyl)urea (CAS 1333862-49-9) is a chemical compound with the molecular formula C10H10BrF3N2O2 and a molecular weight of 327.10 g/mol. IUPAC name: 1-(3-bromo-4-methoxyphenyl)-3-(2,2,2-trifluoroethyl)urea. InChIKey: WTFSYZQUSMOUKH-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3N2O2 |
|---|---|
| Molecular weight | 327.10 g/mol |
| IUPAC name | 1-(3-bromo-4-methoxyphenyl)-3-(2,2,2-trifluoroethyl)urea |
| InChIKey | WTFSYZQUSMOUKH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NC(=O)NCC(F)(F)F)Br |
Computed by PubChem (NCBI)