CAS 1333903-45-9 is the registry number for N(S)-(2-(Diphenylphosphino)-6-methylphenyl)-N-methyladamantan-1-amine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-diphenylphosphanyl-6-methylphenyl)-N-methyladamantan-1-amine (CAS 1333903-45-9) is a chemical compound with the molecular formula C30H34NP and a molecular weight of 439.6 g/mol. IUPAC name: N-(2-diphenylphosphanyl-6-methylphenyl)-N-methyladamantan-1-amine. InChIKey: ZFVKYSBEBCYADT-UHFFFAOYSA-N.
| Molecular formula | C30H34NP |
|---|---|
| Molecular weight | 439.6 g/mol |
| IUPAC name | N-(2-diphenylphosphanyl-6-methylphenyl)-N-methyladamantan-1-amine |
| InChIKey | ZFVKYSBEBCYADT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)P(C2=CC=CC=C2)C3=CC=CC=C3)N(C)C45CC6CC(C4)CC(C6)C5 |
Computed by PubChem (NCBI)