CAS 133410-92-1 is the registry number for H-D-Arg-Phe-OH acetate salt. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg.
(2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid (CAS 133410-92-1) is a chemical compound with the molecular formula C15H23N5O3 and a molecular weight of 321.37 g/mol. IUPAC name: (2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid. InChIKey: PQBHGSGQZSOLIR-NEPJUHHUSA-N.
| Molecular formula | C15H23N5O3 |
|---|---|
| Molecular weight | 321.37 g/mol |
| IUPAC name | (2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | PQBHGSGQZSOLIR-NEPJUHHUSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)[C@@H](CCCN=C(N)N)N |
Computed by PubChem (NCBI)