Products 1334148-14-9
CAS 1334148-14-9 appears in our catalog under these names: 2-Chloro-N,N-dimethyl-6-(trifluoromethyl)pyrimidin-4-amine, 98%, 2-Chloro-N,N-dimethyl-6-(trifluoromethyl)pyrimidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g, 50mg.
2-chloro-N,N-dimethyl-6-(trifluoromethyl)pyrimidin-4-amine (CAS 1334148-14-9) is a chemical compound with the molecular formula C7H7ClF3N3 and a molecular weight of 225.60 g/mol. IUPAC name: 2-chloro-N,N-dimethyl-6-(trifluoromethyl)pyrimidin-4-amine. InChIKey: UZJMYBPLMQTGFK-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3N3 |
|---|---|
| Molecular weight | 225.60 g/mol |
| IUPAC name | 2-chloro-N,N-dimethyl-6-(trifluoromethyl)pyrimidin-4-amine |
| InChIKey | UZJMYBPLMQTGFK-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=NC(=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)