CAS 1334149-01-7 appears in our catalog under these names: 6-Bromo-2-(chloromethyl)-3H-imidazo(4,5-b)pyridine hydrochloride, 95%, 6-Bromo-2-(chloromethyl)-3H-imidazo(4,5-b)pyridine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6-bromo-2-(chloromethyl)-1H-imidazo[4,5-b]pyridine;hydrochloride (CAS 1334149-01-7) is a chemical compound with the molecular formula C7H6BrCl2N3 and a molecular weight of 282.95 g/mol. IUPAC name: 6-bromo-2-(chloromethyl)-1H-imidazo[4,5-b]pyridine;hydrochloride. InChIKey: DCFOVWBVMOJBFL-UHFFFAOYSA-N.
| Molecular formula | C7H6BrCl2N3 |
|---|---|
| Molecular weight | 282.95 g/mol |
| IUPAC name | 6-bromo-2-(chloromethyl)-1H-imidazo[4,5-b]pyridine;hydrochloride |
| InChIKey | DCFOVWBVMOJBFL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1NC(=N2)CCl)Br.Cl |
Computed by PubChem (NCBI)