CAS 1334167-66-6 is the registry number for 4–(2–Fluoro–4–nitrophenyl)–1–methyl–1,4,5,6–tetrahydro–1,2,4–triazine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
4-(2-fluoro-4-nitrophenyl)-1-methyl-5,6-dihydro-1,2,4-triazine (CAS 1334167-66-6) is a chemical compound with the molecular formula C10H11FN4O2 and a molecular weight of 238.22 g/mol. IUPAC name: 4-(2-fluoro-4-nitrophenyl)-1-methyl-5,6-dihydro-1,2,4-triazine. InChIKey: WPHDTSSFCJMKCK-UHFFFAOYSA-N.
| Molecular formula | C10H11FN4O2 |
|---|---|
| Molecular weight | 238.22 g/mol |
| IUPAC name | 4-(2-fluoro-4-nitrophenyl)-1-methyl-5,6-dihydro-1,2,4-triazine |
| InChIKey | WPHDTSSFCJMKCK-UHFFFAOYSA-N |
| SMILES | CN1CCN(C=N1)C2=C(C=C(C=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)