CAS 1334171-90-2 is the registry number for (E)-1,3-Bis(4-(tert-butyl)phenyl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-bis(4-tert-butylphenyl)prop-2-en-1-one (CAS 1334171-90-2) is a chemical compound with the molecular formula C23H28O and a molecular weight of 320.5 g/mol. IUPAC name: 1,3-bis(4-tert-butylphenyl)prop-2-en-1-one. InChIKey: DLTLJPHIQGOXIB-UHFFFAOYSA-N.
| Molecular formula | C23H28O |
|---|---|
| Molecular weight | 320.5 g/mol |
| IUPAC name | 1,3-bis(4-tert-butylphenyl)prop-2-en-1-one |
| InChIKey | DLTLJPHIQGOXIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C=CC(=O)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)