CAS 1334203-56-3 appears in our catalog under these names: 1-(Propan-2-yl)-4,5,6,7-tetrahydro-1H-indazol-6-amine, 95%, 1-(Propan-2-yl)-4,5,6,7-tetrahydro-1H-indazol-6-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-propan-2-yl-4,5,6,7-tetrahydroindazol-6-amine (CAS 1334203-56-3) is a chemical compound with the molecular formula C10H17N3 and a molecular weight of 179.26 g/mol. IUPAC name: 1-propan-2-yl-4,5,6,7-tetrahydroindazol-6-amine. InChIKey: KYHNEDNGQLMOER-UHFFFAOYSA-N.
| Molecular formula | C10H17N3 |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | 1-propan-2-yl-4,5,6,7-tetrahydroindazol-6-amine |
| InChIKey | KYHNEDNGQLMOER-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(CCC(C2)N)C=N1 |
Computed by PubChem (NCBI)