Products 133430-69-0
CAS 133430-69-0 is the registry number for ETH-615. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[N-[(3-fluorophenyl)methyl]-4-(quinolin-2-ylmethoxy)anilino]methyl]benzoic acid (CAS 133430-69-0) is a chemical compound with the molecular formula C31H25FN2O3 and a molecular weight of 492.5 g/mol. IUPAC name: 4-[[N-[(3-fluorophenyl)methyl]-4-(quinolin-2-ylmethoxy)anilino]methyl]benzoic acid. InChIKey: KRCUWCAUDKTMPB-UHFFFAOYSA-N.
| Molecular formula | C31H25FN2O3 |
|---|---|
| Molecular weight | 492.5 g/mol |
| IUPAC name | 4-[[N-[(3-fluorophenyl)methyl]-4-(quinolin-2-ylmethoxy)anilino]methyl]benzoic acid |
| InChIKey | KRCUWCAUDKTMPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)COC3=CC=C(C=C3)N(CC4=CC=C(C=C4)C(=O)O)CC5=CC(=CC=C5)F |
Computed by PubChem (NCBI)