CAS 133430-99-6 appears in our catalog under these names: (4–iodophenoxy)(tert–butyl)dimethylsilane, tert-Butyl(4-iodophenoxy)dimethylsilane 97%, 1-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-4-iodobenzene, 97%, 97%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
Tert-butyl-(4-iodophenoxy)-dimethylsilane (CAS 133430-99-6) is a chemical compound with the molecular formula C12H19IOSi and a molecular weight of 334.27 g/mol. IUPAC name: tert-butyl-(4-iodophenoxy)-dimethylsilane. InChIKey: FVXATZLWJPLBPP-UHFFFAOYSA-N.
| Molecular formula | C12H19IOSi |
|---|---|
| Molecular weight | 334.27 g/mol |
| IUPAC name | tert-butyl-(4-iodophenoxy)-dimethylsilane |
| InChIKey | FVXATZLWJPLBPP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=C(C=C1)I |
Computed by PubChem (NCBI)