CAS 1334486-19-9 is the registry number for 7-Phenyl-3H-pyrimido(4,5-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-phenyl-6H-pyrimido[4,5-d]pyrimidin-5-one (CAS 1334486-19-9) is a chemical compound with the molecular formula C12H8N4O and a molecular weight of 224.22 g/mol. IUPAC name: 2-phenyl-6H-pyrimido[4,5-d]pyrimidin-5-one. InChIKey: GFBGODKWXVJSIS-UHFFFAOYSA-N.
| Molecular formula | C12H8N4O |
|---|---|
| Molecular weight | 224.22 g/mol |
| IUPAC name | 2-phenyl-6H-pyrimido[4,5-d]pyrimidin-5-one |
| InChIKey | GFBGODKWXVJSIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C3C(=O)NC=NC3=N2 |
Computed by PubChem (NCBI)