CAS 1334494-13-1 appears in our catalog under these names: tert-Butyl 4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)piperidine-1-carboxylate, 95%, tert-Butyl 4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)piperidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)piperidine-1-carboxylate (CAS 1334494-13-1) is a chemical compound with the molecular formula C13H22F3NO3 and a molecular weight of 297.31 g/mol. IUPAC name: tert-butyl 4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)piperidine-1-carboxylate. InChIKey: BRPRFRQFLQOQAW-UHFFFAOYSA-N.
| Molecular formula | C13H22F3NO3 |
|---|---|
| Molecular weight | 297.31 g/mol |
| IUPAC name | tert-butyl 4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)piperidine-1-carboxylate |
| InChIKey | BRPRFRQFLQOQAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(C)(C(F)(F)F)O |
Computed by PubChem (NCBI)