CAS 1334703-07-9 appears in our catalog under these names: Zoledronic Acid Impurity 3, Zoledronic acid Impurity 5, Zoledronic Acid Impurity 8, 1,3-Bis(2-ethoxy-2-oxoethyl)-1H-imidazolium Chloride. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
Ethyl 2-[3-(2-ethoxy-2-oxoethyl)imidazol-3-ium-1-yl]acetate chloride (CAS 1334703-07-9) is a chemical compound with the molecular formula C11H17ClN2O4 and a molecular weight of 276.71 g/mol. IUPAC name: ethyl 2-[3-(2-ethoxy-2-oxoethyl)imidazol-3-ium-1-yl]acetate chloride. InChIKey: MAJKZDUHJIAAEJ-UHFFFAOYSA-M.
| Molecular formula | C11H17ClN2O4 |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | ethyl 2-[3-(2-ethoxy-2-oxoethyl)imidazol-3-ium-1-yl]acetate chloride |
| InChIKey | MAJKZDUHJIAAEJ-UHFFFAOYSA-M |
| SMILES | CCOC(=O)CN1C=C[N+](=C1)CC(=O)OCC.[Cl-] |
Computed by PubChem (NCBI)