CAS 133471-06-4 is the registry number for 3',5'-Di-o-acetyl-O6-phenyl-2'-deoxyinosine. Offered by: Biosynth. Available pack sizes: 5000mg.
[(2R,3S,5R)-3-acetyloxy-5-(6-phenoxypurin-9-yl)oxolan-2-yl]methyl acetate (CAS 133471-06-4) is a chemical compound with the molecular formula C20H20N4O6 and a molecular weight of 412.4 g/mol. IUPAC name: [(2R,3S,5R)-3-acetyloxy-5-(6-phenoxypurin-9-yl)oxolan-2-yl]methyl acetate. InChIKey: PHPOEQOFLFRTBK-GVDBMIGSSA-N.
| Molecular formula | C20H20N4O6 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | [(2R,3S,5R)-3-acetyloxy-5-(6-phenoxypurin-9-yl)oxolan-2-yl]methyl acetate |
| InChIKey | PHPOEQOFLFRTBK-GVDBMIGSSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H](C[C@@H](O1)N2C=NC3=C2N=CN=C3OC4=CC=CC=C4)OC(=O)C |
Computed by PubChem (NCBI)