CAS 133481-12-6 is the registry number for Gabapentin EP Impurity B Potassium Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium 2-(1-cyanocyclohexyl)acetate (CAS 133481-12-6) is a chemical compound with the molecular formula C9H12KNO2 and a molecular weight of 205.30 g/mol. IUPAC name: potassium 2-(1-cyanocyclohexyl)acetate. InChIKey: AIPKMNGCAXYDJB-UHFFFAOYSA-M.
| Molecular formula | C9H12KNO2 |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | potassium 2-(1-cyanocyclohexyl)acetate |
| InChIKey | AIPKMNGCAXYDJB-UHFFFAOYSA-M |
| SMILES | C1CCC(CC1)(CC(=O)[O-])C#N.[K+] |
Computed by PubChem (NCBI)