Products 1334953-41-1

CAS 1334953-41-1 is the registry number for (2-[2-(6-Chloro-hexyloxy)-ethoxy]-ethyl)-carbamic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate (CAS 1334953-41-1) is a chemical compound with the molecular formula C18H28ClNO4 and a molecular weight of 357.9 g/mol. IUPAC name: benzyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate. InChIKey: SIEXBOGDNOFGSE-UHFFFAOYSA-N.

Identity
Molecular formulaC18H28ClNO4
Molecular weight357.9 g/mol
IUPAC namebenzyl N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]carbamate
InChIKeySIEXBOGDNOFGSE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NCCOCCOCCCCCCCl

Computed by PubChem (NCBI)