CAS 1335013-55-2 is the registry number for 2,2,2-Trifluoro-1-(4-fluoro-3-(trifluoromethyl)phenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2,2-trifluoro-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanone (CAS 1335013-55-2) is a chemical compound with the molecular formula C9H3F7O and a molecular weight of 260.11 g/mol. IUPAC name: 2,2,2-trifluoro-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanone. InChIKey: BGAMLBLEPGFYPV-UHFFFAOYSA-N.
| Molecular formula | C9H3F7O |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanone |
| InChIKey | BGAMLBLEPGFYPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(F)(F)F)C(F)(F)F)F |
Computed by PubChem (NCBI)