Products 1335014-65-7
CAS 1335014-65-7 appears in our catalog under these names: 3,5-Dimethylbenzoic-d9 Acid, 3,5-Dimethylbenzoic-d9 Acid, 98 atom % D, min 98% Chemical Purity, 3,5-Dimethylbenzoic acid-d9. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 250mg, 25mg, 1g, 0,5g, 10 mg, 25 mg, 100 mg.
2,4,6-trideuterio-3,5-bis(trideuteriomethyl)benzoic acid (CAS 1335014-65-7) is a chemical compound with the molecular formula C9H10O2 and a molecular weight of 159.23 g/mol. IUPAC name: 2,4,6-trideuterio-3,5-bis(trideuteriomethyl)benzoic acid. InChIKey: UMVOQQDNEYOJOK-XVGWXEQOSA-N.
| Molecular formula | C9H10O2 |
|---|---|
| Molecular weight | 159.23 g/mol |
| IUPAC name | 2,4,6-trideuterio-3,5-bis(trideuteriomethyl)benzoic acid |
| InChIKey | UMVOQQDNEYOJOK-XVGWXEQOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])[2H])C(=O)O |
Computed by PubChem (NCBI)