Products 1335093-29-2

CAS 1335093-29-2 is the registry number for 3-NH2-3,4-Me2-pent-4-enoic acid. Offered by: Iris Biotech. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-amino-3,4-dimethylpent-4-enoic acid (CAS 1335093-29-2) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: 3-amino-3,4-dimethylpent-4-enoic acid. InChIKey: KAMQUXAFIMGJET-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13NO2
Molecular weight143.18 g/mol
IUPAC name3-amino-3,4-dimethylpent-4-enoic acid
InChIKeyKAMQUXAFIMGJET-UHFFFAOYSA-N
SMILESCC(=C)C(C)(CC(=O)O)N

Computed by PubChem (NCBI)