CAS 1335333-86-2 is the registry number for 4'-Fluoroacetophenone-d4. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(2,3,5,6-tetradeuterio-4-fluorophenyl)ethanone (CAS 1335333-86-2) is a chemical compound with the molecular formula C8H7FO and a molecular weight of 142.16 g/mol. IUPAC name: 1-(2,3,5,6-tetradeuterio-4-fluorophenyl)ethanone. InChIKey: ZDPAWHACYDRYIW-QFFDRWTDSA-N.
| Molecular formula | C8H7FO |
|---|---|
| Molecular weight | 142.16 g/mol |
| IUPAC name | 1-(2,3,5,6-tetradeuterio-4-fluorophenyl)ethanone |
| InChIKey | ZDPAWHACYDRYIW-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)C)[2H])[2H])F)[2H] |
Computed by PubChem (NCBI)