Products 1335401-17-6
CAS 1335401-17-6 appears in our catalog under these names: Eugenol-d3, >95% (HPLC), Eugenol D3 (methoxy D3), Eugenol–d3, Eugenol-d3, 98.52%, D3-Eugenol. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 5 mg, 25 mg, 10mM/1mL, 50 mg.
4-prop-2-enyl-2-(trideuteriomethoxy)phenol (CAS 1335401-17-6) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 167.22 g/mol. IUPAC name: 4-prop-2-enyl-2-(trideuteriomethoxy)phenol. InChIKey: RRAFCDWBNXTKKO-BMSJAHLVSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 167.22 g/mol |
| IUPAC name | 4-prop-2-enyl-2-(trideuteriomethoxy)phenol |
| InChIKey | RRAFCDWBNXTKKO-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)CC=C)O |
Computed by PubChem (NCBI)