Products 1335401-74-5
CAS 1335401-74-5 appears in our catalog under these names: Ethyl-d5 Vanillin, Ethyl Vanillin-d5, Ethyl-d5 Vanillin, >95% (HPLC), Ethylvanillin-d5, D5-Ethyl-vanillin. Offered by: Chemat Brand, Hubei YoungXin, TRC, TargetMol, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
4-hydroxy-3-(1,1,2,2,2-pentadeuterioethoxy)benzaldehyde (CAS 1335401-74-5) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 171.20 g/mol. IUPAC name: 4-hydroxy-3-(1,1,2,2,2-pentadeuterioethoxy)benzaldehyde. InChIKey: CBOQJANXLMLOSS-ZBJDZAJPSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 4-hydroxy-3-(1,1,2,2,2-pentadeuterioethoxy)benzaldehyde |
| InChIKey | CBOQJANXLMLOSS-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=C(C=CC(=C1)C=O)O |
Computed by PubChem (NCBI)