Products 1335435-91-0
CAS 1335435-91-0 is the registry number for 2-Nonen-1-ol-D2. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg.
(E)-2,3-dideuterionon-2-en-1-ol (CAS 1335435-91-0) is a chemical compound with the molecular formula C9H18O and a molecular weight of 144.25 g/mol. IUPAC name: (E)-2,3-dideuterionon-2-en-1-ol. InChIKey: NSSALFVIQPAIQK-NGFFTCBCSA-N.
| Molecular formula | C9H18O |
|---|---|
| Molecular weight | 144.25 g/mol |
| IUPAC name | (E)-2,3-dideuterionon-2-en-1-ol |
| InChIKey | NSSALFVIQPAIQK-NGFFTCBCSA-N |
| SMILES | [2H]/C(=C(/[2H])\CO)/CCCCCC |
Computed by PubChem (NCBI)