Products 1335561-83-5
CAS 1335561-83-5 is the registry number for (R)-5-amino-1-chloro-5,6,7,8-tetrahydronaphthalen-2-ol hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(5R)-5-amino-1-chloro-5,6,7,8-tetrahydronaphthalen-2-ol (CAS 1335561-83-5) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: (5R)-5-amino-1-chloro-5,6,7,8-tetrahydronaphthalen-2-ol. InChIKey: SNRNZZPWCMXIAP-MRVPVSSYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | (5R)-5-amino-1-chloro-5,6,7,8-tetrahydronaphthalen-2-ol |
| InChIKey | SNRNZZPWCMXIAP-MRVPVSSYSA-N |
| SMILES | C1C[C@H](C2=C(C1)C(=C(C=C2)O)Cl)N |
Computed by PubChem (NCBI)