CAS 133559-43-0 appears in our catalog under these names: 3-Trifluoromethanesulfonyloxy-but-2-enoic acid methyl ester, 98%, Methyl 3-(((trifluoromethyl)sulfonyl)oxy)but-2-enoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 25g.
Methyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate (CAS 133559-43-0) is a chemical compound with the molecular formula C6H7F3O5S and a molecular weight of 248.18 g/mol. IUPAC name: methyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate. InChIKey: RSNDRPHGOLGQLG-ARJAWSKDSA-N.
| Molecular formula | C6H7F3O5S |
|---|---|
| Molecular weight | 248.18 g/mol |
| IUPAC name | methyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate |
| InChIKey | RSNDRPHGOLGQLG-ARJAWSKDSA-N |
| SMILES | C/C(=C/C(=O)OC)/OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)