CAS 133560-58-4 is the registry number for 4-Bromo-1-{[2-(trimethylsilyl)ethoxy]methyl}pyrazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[(4-bromopyrazol-1-yl)methoxy]ethyl-trimethylsilane (CAS 133560-58-4) is a chemical compound with the molecular formula C9H17BrN2OSi and a molecular weight of 277.23 g/mol. IUPAC name: 2-[(4-bromopyrazol-1-yl)methoxy]ethyl-trimethylsilane. InChIKey: DIEAIDCZEZGMJP-UHFFFAOYSA-N.
| Molecular formula | C9H17BrN2OSi |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | 2-[(4-bromopyrazol-1-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | DIEAIDCZEZGMJP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCN1C=C(C=N1)Br |
Computed by PubChem (NCBI)