CAS 1336723-71-7 is the registry number for (S)-2-(4-Bromo-2-chloro-5-fluorophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(4-bromo-2-chloro-5-fluorophenyl)pyrrolidine (CAS 1336723-71-7) is a chemical compound with the molecular formula C10H10BrClFN and a molecular weight of 278.55 g/mol. IUPAC name: (2S)-2-(4-bromo-2-chloro-5-fluorophenyl)pyrrolidine. InChIKey: UDFQFWRCGXRAIV-JTQLQIEISA-N.
| Molecular formula | C10H10BrClFN |
|---|---|
| Molecular weight | 278.55 g/mol |
| IUPAC name | (2S)-2-(4-bromo-2-chloro-5-fluorophenyl)pyrrolidine |
| InChIKey | UDFQFWRCGXRAIV-JTQLQIEISA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=C(C=C2Cl)Br)F |
Computed by PubChem (NCBI)