Products 1337141-00-0
CAS 1337141-00-0 is the registry number for 1-Naphthalenamine, 6-fluoro-1,2,3,4-tetrahydro-7-(trifluoromethoxy)-, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-7-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1337141-00-0) is a chemical compound with the molecular formula C11H11F4NO and a molecular weight of 249.20 g/mol. IUPAC name: 6-fluoro-7-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: IVILLNCUTUMHCJ-UHFFFAOYSA-N.
| Molecular formula | C11H11F4NO |
|---|---|
| Molecular weight | 249.20 g/mol |
| IUPAC name | 6-fluoro-7-(trifluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | IVILLNCUTUMHCJ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC(=C(C=C2C1)F)OC(F)(F)F)N |
Computed by PubChem (NCBI)