CAS 1337243-83-0 is the registry number for 1-(2,3,6-Trichlorophenyl)ethan-1-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(2,3,6-trichlorophenyl)ethanamine (CAS 1337243-83-0) is a chemical compound with the molecular formula C8H8Cl3N and a molecular weight of 224.5 g/mol. IUPAC name: 1-(2,3,6-trichlorophenyl)ethanamine. InChIKey: RMSVGGMTLNPBER-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3N |
|---|---|
| Molecular weight | 224.5 g/mol |
| IUPAC name | 1-(2,3,6-trichlorophenyl)ethanamine |
| InChIKey | RMSVGGMTLNPBER-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1Cl)Cl)Cl)N |
Computed by PubChem (NCBI)