CAS 133726-85-9 appears in our catalog under these names: 2-(Thiophen-2-yl)-1H-1,3-benzodiazol-5-amine dihydrochloride, 95%, 2-(Thiophen-2-yl)-1H-1,3-benzodiazol-5-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-thiophen-2-yl-3H-benzimidazol-5-amine;dihydrochloride (CAS 133726-85-9) is a chemical compound with the molecular formula C11H11Cl2N3S and a molecular weight of 288.2 g/mol. IUPAC name: 2-thiophen-2-yl-3H-benzimidazol-5-amine;dihydrochloride. InChIKey: UIQVJXHCVRONRC-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N3S |
|---|---|
| Molecular weight | 288.2 g/mol |
| IUPAC name | 2-thiophen-2-yl-3H-benzimidazol-5-amine;dihydrochloride |
| InChIKey | UIQVJXHCVRONRC-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC3=C(N2)C=C(C=C3)N.Cl.Cl |
Computed by PubChem (NCBI)