CAS 133737-48-1 appears in our catalog under these names: Pagoclone, rac-Pagoclone, >95% (HPLC). Offered by: GLPBio, TRC. Available pack sizes: 1mg, 10mg, 5mg.
2-(7-chloro-1,8-naphthyridin-2-yl)-3-(5-methyl-2-oxohexyl)-3H-isoindol-1-one (CAS 133737-48-1) is a chemical compound with the molecular formula C23H22ClN3O2 and a molecular weight of 407.9 g/mol. IUPAC name: 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(5-methyl-2-oxohexyl)-3H-isoindol-1-one. InChIKey: HIUPRQPBWVEQJJ-UHFFFAOYSA-N.
| Molecular formula | C23H22ClN3O2 |
|---|---|
| Molecular weight | 407.9 g/mol |
| IUPAC name | 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(5-methyl-2-oxohexyl)-3H-isoindol-1-one |
| InChIKey | HIUPRQPBWVEQJJ-UHFFFAOYSA-N |
| SMILES | CC(C)CCC(=O)CC1C2=CC=CC=C2C(=O)N1C3=NC4=C(C=C3)C=CC(=N4)Cl |
Computed by PubChem (NCBI)