CAS 1337733-98-8 is the registry number for 6-Fluoro-5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1337733-98-8) is a chemical compound with the molecular formula C11H11F4N and a molecular weight of 233.20 g/mol. IUPAC name: 6-fluoro-5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: DMGXYIXXMUEWES-UHFFFAOYSA-N.
| Molecular formula | C11H11F4N |
|---|---|
| Molecular weight | 233.20 g/mol |
| IUPAC name | 6-fluoro-5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | DMGXYIXXMUEWES-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=C(C=C2)F)C(F)(F)F)N |
Computed by PubChem (NCBI)