CAS 133776-42-8 is the registry number for ((4-Bromobenzyl)oxy)(tert-butyl)diphenylsilane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-bromophenyl)methoxy-tert-butyl-diphenylsilane (CAS 133776-42-8) is a chemical compound with the molecular formula C23H25BrOSi and a molecular weight of 425.4 g/mol. IUPAC name: (4-bromophenyl)methoxy-tert-butyl-diphenylsilane. InChIKey: TYWSGDVBXZNFND-UHFFFAOYSA-N.
| Molecular formula | C23H25BrOSi |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | (4-bromophenyl)methoxy-tert-butyl-diphenylsilane |
| InChIKey | TYWSGDVBXZNFND-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)